C26H28F3N7O6S — CID 122702006
(1R,2S)-N-[4-(2,6-dimethoxyphenyl)-5-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]-1,2,4-triazol-3-yl]-1-methoxy-1-(5-methylpyrimidin-2-yl)propane-2-sulfonamide (PubChem CID 122702006) has the molecular formula C26H28F3N7O6S and a molecular weight of 623.61 g/mol. Its IUPAC name is (1R,2S)-N-[4-(2,6-dimethoxyphenyl)-5-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]-1,2,4-triazol-3-yl]-1-methoxy-1-(5-methylpyrimidin-2-yl)propane-2-sulfonamide.
| Compound Name | (1R,2S)-N-[4-(2,6-dimethoxyphenyl)-5-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]-1,2,4-triazol-3-yl]-1-methoxy-1-(5-methylpyrimidin-2-yl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 122702006 |
| Molecular Formula | C26H28F3N7O6S |
| Molecular Weight | 623.61 g/mol |
| Exact Mass | 623.18 |
| IUPAC Name | (1R,2S)-N-[4-(2,6-dimethoxyphenyl)-5-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]-1,2,4-triazol-3-yl]-1-methoxy-1-(5-methylpyrimidin-2-yl)propane-2-sulfonamide |
| SMILES | COc1cccc(OC)c1-n1c(NS(=O)(=O)[C@@H](C)[C@H](OC)c2ncc(C)cn2)nnc1-c1cccc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C26H28F3N7O6S/c1-15-12-30-23(31-13-15)22(41-5)16(2)43(37,38)35-25-34-33-24(17-8-6-11-20(32-17)42-14-26(27,28)29)36(25)21-18(39-3)9-7-10-19(21)40-4/h6-13,16,22H,14H2,1-5H3,(H,34,35)/t16-,22-/m0/s1 |
| InChIKey | SVAFMWATBWDOAG-AOMKIAJQSA-N |
| XLogP | 3.90 |
| TPSA | 152.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.61 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |