About 1-[3-(1H-indol-5-yl)-3,4-dihydropyrazol-2-yl]-2,2-dimethylpropan-1-one
1-[3-(1H-indol-5-yl)-3,4-dihydropyrazol-2-yl]-2,2-dimethylpropan-1-one (PubChem CID 122703555) has the molecular formula C16H19N3O
and a molecular weight of 269.35 g/mol. Its IUPAC name is 1-[3-(1H-indol-5-yl)-3,4-dihydropyrazol-2-yl]-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-[3-(1H-indol-5-yl)-3,4-dihydropyrazol-2-yl]-2,2-dimethylpropan-1-one |
| PubChem CID | 122703555 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 1-[3-(1H-indol-5-yl)-3,4-dihydropyrazol-2-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)N1N=CCC1c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C16H19N3O/c1-16(2,3)15(20)19-14(7-9-18-19)12-4-5-13-11(10-12)6-8-17-13/h4-6,8-10,14,17H,7H2,1-3H3 |
| InChIKey | YMTRABOHMTVDQT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 48.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3-(1H-indol-5-yl)-3,4-dihydropyrazol-2-yl]-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(1H-indol-5-yl)-3,4-dihydropyrazol-2-yl]-2,2-dimethylpropan-1-one?
The IUPAC name of 1-[3-(1H-indol-5-yl)-3,4-dihydropyrazol-2-yl]-2,2-dimethylpropan-1-one (CID 122703555) is 1-[3-(1H-indol-5-yl)-3,4-dihydropyrazol-2-yl]-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-[3-(1H-indol-5-yl)-3,4-dihydropyrazol-2-yl]-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-[3-(1H-indol-5-yl)-3,4-dihydropyrazol-2-yl]-2,2-dimethylpropan-1-one is CC(C)(C)C(=O)N1N=CCC1c1ccc2[nH]ccc2c1.
What is the InChIKey of 1-[3-(1H-indol-5-yl)-3,4-dihydropyrazol-2-yl]-2,2-dimethylpropan-1-one?
The InChIKey is YMTRABOHMTVDQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O/c1-16(2,3)15(20)19-14(7-9-18-19)12-4-5-13-11(10-12)6-8-17-13/h4-6,8-10,14,17H,7H2,1-3H3.
What are the key properties of 1-[3-(1H-indol-5-yl)-3,4-dihydropyrazol-2-yl]-2,2-dimethylpropan-1-one?
1-[3-(1H-indol-5-yl)-3,4-dihydropyrazol-2-yl]-2,2-dimethylpropan-1-one has a molecular weight of 269.35 g/mol, XLogP of 3.47, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(1H-indol-5-yl)-3,4-dihydropyrazol-2-yl]-2,2-dimethylpropan-1-one is sourced from PubChem (CID 122703555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).