About oxan-4-yl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone
oxan-4-yl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone (PubChem CID 122703561) has the molecular formula C15H18N2O2
and a molecular weight of 258.32 g/mol. Its IUPAC name is oxan-4-yl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone.
Molecular Properties
| Compound Name | oxan-4-yl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone |
| PubChem CID | 122703561 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | oxan-4-yl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone |
| SMILES | O=C(C1CCOCC1)N1N=CCC1c1ccccc1 |
| InChI | InChI=1S/C15H18N2O2/c18-15(13-7-10-19-11-8-13)17-14(6-9-16-17)12-4-2-1-3-5-12/h1-5,9,13-14H,6-8,10-11H2 |
| InChIKey | VCBLHMUYNPNWHV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze oxan-4-yl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-yl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone?
The IUPAC name of oxan-4-yl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone (CID 122703561) is oxan-4-yl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone.
What is the SMILES notation for oxan-4-yl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone?
The canonical SMILES for oxan-4-yl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone is O=C(C1CCOCC1)N1N=CCC1c1ccccc1.
What is the InChIKey of oxan-4-yl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone?
The InChIKey is VCBLHMUYNPNWHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2/c18-15(13-7-10-19-11-8-13)17-14(6-9-16-17)12-4-2-1-3-5-12/h1-5,9,13-14H,6-8,10-11H2.
What are the key properties of oxan-4-yl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone?
oxan-4-yl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone has a molecular weight of 258.32 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-yl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone is sourced from PubChem (CID 122703561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).