About cyclopentyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone
cyclopentyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone (PubChem CID 122703585) has the molecular formula C15H18N2O
and a molecular weight of 242.32 g/mol. Its IUPAC name is cyclopentyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone.
Molecular Properties
| Compound Name | cyclopentyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone |
| PubChem CID | 122703585 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | cyclopentyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone |
| SMILES | O=C(C1CCCC1)N1N=CCC1c1ccccc1 |
| InChI | InChI=1S/C15H18N2O/c18-15(13-8-4-5-9-13)17-14(10-11-16-17)12-6-2-1-3-7-12/h1-3,6-7,11,13-14H,4-5,8-10H2 |
| InChIKey | QKVJJBFCEGFPPG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopentyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone?
The IUPAC name of cyclopentyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone (CID 122703585) is cyclopentyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone.
What is the SMILES notation for cyclopentyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone?
The canonical SMILES for cyclopentyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone is O=C(C1CCCC1)N1N=CCC1c1ccccc1.
What is the InChIKey of cyclopentyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone?
The InChIKey is QKVJJBFCEGFPPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O/c18-15(13-8-4-5-9-13)17-14(10-11-16-17)12-6-2-1-3-7-12/h1-3,6-7,11,13-14H,4-5,8-10H2.
What are the key properties of cyclopentyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone?
cyclopentyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone has a molecular weight of 242.32 g/mol, XLogP of 3.14, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone is sourced from PubChem (CID 122703585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).