About cyclobutyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone
cyclobutyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone (PubChem CID 122703599) has the molecular formula C14H16N2O
and a molecular weight of 228.30 g/mol. Its IUPAC name is cyclobutyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone.
Molecular Properties
| Compound Name | cyclobutyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone |
| PubChem CID | 122703599 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | cyclobutyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone |
| SMILES | O=C(C1CCC1)N1N=CCC1c1ccccc1 |
| InChI | InChI=1S/C14H16N2O/c17-14(12-7-4-8-12)16-13(9-10-15-16)11-5-2-1-3-6-11/h1-3,5-6,10,12-13H,4,7-9H2 |
| InChIKey | BULOQKINPKUMDS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclobutyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone?
The IUPAC name of cyclobutyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone (CID 122703599) is cyclobutyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone.
What is the SMILES notation for cyclobutyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone?
The canonical SMILES for cyclobutyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone is O=C(C1CCC1)N1N=CCC1c1ccccc1.
What is the InChIKey of cyclobutyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone?
The InChIKey is BULOQKINPKUMDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O/c17-14(12-7-4-8-12)16-13(9-10-15-16)11-5-2-1-3-6-11/h1-3,5-6,10,12-13H,4,7-9H2.
What are the key properties of cyclobutyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone?
cyclobutyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone has a molecular weight of 228.30 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone is sourced from PubChem (CID 122703599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).