About (3-phenyl-3,4-dihydropyrazol-2-yl)-[1-(2H-triazole-4-carbonyl)piperidin-4-yl]methanone
(3-phenyl-3,4-dihydropyrazol-2-yl)-[1-(2H-triazole-4-carbonyl)piperidin-4-yl]methanone (PubChem CID 122703637) has the molecular formula C18H20N6O2
and a molecular weight of 352.40 g/mol. Its IUPAC name is (3-phenyl-3,4-dihydropyrazol-2-yl)-[1-(2H-triazole-4-carbonyl)piperidin-4-yl]methanone.
Molecular Properties
| Compound Name | (3-phenyl-3,4-dihydropyrazol-2-yl)-[1-(2H-triazole-4-carbonyl)piperidin-4-yl]methanone |
| PubChem CID | 122703637 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (3-phenyl-3,4-dihydropyrazol-2-yl)-[1-(2H-triazole-4-carbonyl)piperidin-4-yl]methanone |
| SMILES | O=C(c1cn[nH]n1)N1CCC(C(=O)N2N=CCC2c2ccccc2)CC1 |
| InChI | InChI=1S/C18H20N6O2/c25-17(24-16(6-9-20-24)13-4-2-1-3-5-13)14-7-10-23(11-8-14)18(26)15-12-19-22-21-15/h1-5,9,12,14,16H,6-8,10-11H2,(H,19,21,22) |
| InChIKey | VMPIYMFZXCYLDZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-phenyl-3,4-dihydropyrazol-2-yl)-[1-(2H-triazole-4-carbonyl)piperidin-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenyl-3,4-dihydropyrazol-2-yl)-[1-(2H-triazole-4-carbonyl)piperidin-4-yl]methanone?
The IUPAC name of (3-phenyl-3,4-dihydropyrazol-2-yl)-[1-(2H-triazole-4-carbonyl)piperidin-4-yl]methanone (CID 122703637) is (3-phenyl-3,4-dihydropyrazol-2-yl)-[1-(2H-triazole-4-carbonyl)piperidin-4-yl]methanone.
What is the SMILES notation for (3-phenyl-3,4-dihydropyrazol-2-yl)-[1-(2H-triazole-4-carbonyl)piperidin-4-yl]methanone?
The canonical SMILES for (3-phenyl-3,4-dihydropyrazol-2-yl)-[1-(2H-triazole-4-carbonyl)piperidin-4-yl]methanone is O=C(c1cn[nH]n1)N1CCC(C(=O)N2N=CCC2c2ccccc2)CC1.
What is the InChIKey of (3-phenyl-3,4-dihydropyrazol-2-yl)-[1-(2H-triazole-4-carbonyl)piperidin-4-yl]methanone?
The InChIKey is VMPIYMFZXCYLDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N6O2/c25-17(24-16(6-9-20-24)13-4-2-1-3-5-13)14-7-10-23(11-8-14)18(26)15-12-19-22-21-15/h1-5,9,12,14,16H,6-8,10-11H2,(H,19,21,22).
What are the key properties of (3-phenyl-3,4-dihydropyrazol-2-yl)-[1-(2H-triazole-4-carbonyl)piperidin-4-yl]methanone?
(3-phenyl-3,4-dihydropyrazol-2-yl)-[1-(2H-triazole-4-carbonyl)piperidin-4-yl]methanone has a molecular weight of 352.40 g/mol, XLogP of 1.62, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenyl-3,4-dihydropyrazol-2-yl)-[1-(2H-triazole-4-carbonyl)piperidin-4-yl]methanone is sourced from PubChem (CID 122703637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).