About 2-methyl-1-(3-phenyl-3,4-dihydropyrazol-2-yl)propan-1-one
2-methyl-1-(3-phenyl-3,4-dihydropyrazol-2-yl)propan-1-one (PubChem CID 122703716) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-methyl-1-(3-phenyl-3,4-dihydropyrazol-2-yl)propan-1-one.
Molecular Properties
| Compound Name | 2-methyl-1-(3-phenyl-3,4-dihydropyrazol-2-yl)propan-1-one |
| PubChem CID | 122703716 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-methyl-1-(3-phenyl-3,4-dihydropyrazol-2-yl)propan-1-one |
| SMILES | CC(C)C(=O)N1N=CCC1c1ccccc1 |
| InChI | InChI=1S/C13H16N2O/c1-10(2)13(16)15-12(8-9-14-15)11-6-4-3-5-7-11/h3-7,9-10,12H,8H2,1-2H3 |
| InChIKey | GYEXJXFNDIJKJY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-1-(3-phenyl-3,4-dihydropyrazol-2-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-(3-phenyl-3,4-dihydropyrazol-2-yl)propan-1-one?
The IUPAC name of 2-methyl-1-(3-phenyl-3,4-dihydropyrazol-2-yl)propan-1-one (CID 122703716) is 2-methyl-1-(3-phenyl-3,4-dihydropyrazol-2-yl)propan-1-one.
What is the SMILES notation for 2-methyl-1-(3-phenyl-3,4-dihydropyrazol-2-yl)propan-1-one?
The canonical SMILES for 2-methyl-1-(3-phenyl-3,4-dihydropyrazol-2-yl)propan-1-one is CC(C)C(=O)N1N=CCC1c1ccccc1.
What is the InChIKey of 2-methyl-1-(3-phenyl-3,4-dihydropyrazol-2-yl)propan-1-one?
The InChIKey is GYEXJXFNDIJKJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O/c1-10(2)13(16)15-12(8-9-14-15)11-6-4-3-5-7-11/h3-7,9-10,12H,8H2,1-2H3.
What are the key properties of 2-methyl-1-(3-phenyl-3,4-dihydropyrazol-2-yl)propan-1-one?
2-methyl-1-(3-phenyl-3,4-dihydropyrazol-2-yl)propan-1-one has a molecular weight of 216.28 g/mol, XLogP of 2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-(3-phenyl-3,4-dihydropyrazol-2-yl)propan-1-one is sourced from PubChem (CID 122703716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).