C21H21ClN4O2 — CID 122703730
[1-(6-chloropyridine-2-carbonyl)piperidin-4-yl]-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone (PubChem CID 122703730) has the molecular formula C21H21ClN4O2 and a molecular weight of 396.88 g/mol. Its IUPAC name is [1-(6-chloropyridine-2-carbonyl)piperidin-4-yl]-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone.
| Compound Name | [1-(6-chloropyridine-2-carbonyl)piperidin-4-yl]-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone |
|---|---|
| PubChem CID | 122703730 |
| Molecular Formula | C21H21ClN4O2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | [1-(6-chloropyridine-2-carbonyl)piperidin-4-yl]-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone |
| SMILES | O=C(c1cccc(Cl)n1)N1CCC(C(=O)N2N=CCC2c2ccccc2)CC1 |
| InChI | InChI=1S/C21H21ClN4O2/c22-19-8-4-7-17(24-19)21(28)25-13-10-16(11-14-25)20(27)26-18(9-12-23-26)15-5-2-1-3-6-15/h1-8,12,16,18H,9-11,13-14H2 |
| InChIKey | LGIYBVGIGPYOGY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 65.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|