About 2-chloro-4,6-dimethyl-6-(1-methyl-6-oxopyridazin-3-yl)-7,8-dihydroquinolin-5-one
2-chloro-4,6-dimethyl-6-(1-methyl-6-oxopyridazin-3-yl)-7,8-dihydroquinolin-5-one (PubChem CID 122704008) has the molecular formula C16H16ClN3O2
and a molecular weight of 317.78 g/mol. Its IUPAC name is 2-chloro-4,6-dimethyl-6-(1-methyl-6-oxopyridazin-3-yl)-7,8-dihydroquinolin-5-one.
Molecular Properties
| Compound Name | 2-chloro-4,6-dimethyl-6-(1-methyl-6-oxopyridazin-3-yl)-7,8-dihydroquinolin-5-one |
| PubChem CID | 122704008 |
| Molecular Formula | C16H16ClN3O2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 2-chloro-4,6-dimethyl-6-(1-methyl-6-oxopyridazin-3-yl)-7,8-dihydroquinolin-5-one |
| SMILES | Cc1cc(Cl)nc2c1C(=O)C(C)(c1ccc(=O)n(C)n1)CC2 |
| InChI | InChI=1S/C16H16ClN3O2/c1-9-8-12(17)18-10-6-7-16(2,15(22)14(9)10)11-4-5-13(21)20(3)19-11/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | DAUYOWMBDXTQII-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4,6-dimethyl-6-(1-methyl-6-oxopyridazin-3-yl)-7,8-dihydroquinolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4,6-dimethyl-6-(1-methyl-6-oxopyridazin-3-yl)-7,8-dihydroquinolin-5-one?
The IUPAC name of 2-chloro-4,6-dimethyl-6-(1-methyl-6-oxopyridazin-3-yl)-7,8-dihydroquinolin-5-one (CID 122704008) is 2-chloro-4,6-dimethyl-6-(1-methyl-6-oxopyridazin-3-yl)-7,8-dihydroquinolin-5-one.
What is the SMILES notation for 2-chloro-4,6-dimethyl-6-(1-methyl-6-oxopyridazin-3-yl)-7,8-dihydroquinolin-5-one?
The canonical SMILES for 2-chloro-4,6-dimethyl-6-(1-methyl-6-oxopyridazin-3-yl)-7,8-dihydroquinolin-5-one is Cc1cc(Cl)nc2c1C(=O)C(C)(c1ccc(=O)n(C)n1)CC2.
What is the InChIKey of 2-chloro-4,6-dimethyl-6-(1-methyl-6-oxopyridazin-3-yl)-7,8-dihydroquinolin-5-one?
The InChIKey is DAUYOWMBDXTQII-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClN3O2/c1-9-8-12(17)18-10-6-7-16(2,15(22)14(9)10)11-4-5-13(21)20(3)19-11/h4-5,8H,6-7H2,1-3H3.
What are the key properties of 2-chloro-4,6-dimethyl-6-(1-methyl-6-oxopyridazin-3-yl)-7,8-dihydroquinolin-5-one?
2-chloro-4,6-dimethyl-6-(1-methyl-6-oxopyridazin-3-yl)-7,8-dihydroquinolin-5-one has a molecular weight of 317.78 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4,6-dimethyl-6-(1-methyl-6-oxopyridazin-3-yl)-7,8-dihydroquinolin-5-one is sourced from PubChem (CID 122704008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).