C17H12ClF3N4O4S — CID 122704130
[6-(5-chloroimidazo[1,2-a]pyrazin-8-yl)-6-methyl-5-oxo-7,8-dihydroquinolin-2-yl] trifluoromethanesulfonate (PubChem CID 122704130) has the molecular formula C17H12ClF3N4O4S and a molecular weight of 460.82 g/mol. Its IUPAC name is [6-(5-chloroimidazo[1,2-a]pyrazin-8-yl)-6-methyl-5-oxo-7,8-dihydroquinolin-2-yl] trifluoromethanesulfonate.
| Compound Name | [6-(5-chloroimidazo[1,2-a]pyrazin-8-yl)-6-methyl-5-oxo-7,8-dihydroquinolin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 122704130 |
| Molecular Formula | C17H12ClF3N4O4S |
| Molecular Weight | 460.82 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | [6-(5-chloroimidazo[1,2-a]pyrazin-8-yl)-6-methyl-5-oxo-7,8-dihydroquinolin-2-yl] trifluoromethanesulfonate |
| SMILES | CC1(c2ncc(Cl)n3ccnc23)CCc2nc(OS(=O)(=O)C(F)(F)F)ccc2C1=O |
| InChI | InChI=1S/C17H12ClF3N4O4S/c1-16(13-15-22-6-7-25(15)11(18)8-23-13)5-4-10-9(14(16)26)2-3-12(24-10)29-30(27,28)17(19,20)21/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | YKLKRIICOMZRMF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 103.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.82 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|