C16H17BrN6O3S — CID 122704591
N-(3-bromophenyl)-N-hydroxy-2-(2-methylsulfonylethylamino)-1H-imidazo[4,5-b]pyridine-7-carboximidamide (PubChem CID 122704591) has the molecular formula C16H17BrN6O3S and a molecular weight of 453.32 g/mol. Its IUPAC name is N-(3-bromophenyl)-N-hydroxy-2-(2-methylsulfonylethylamino)-1H-imidazo[4,5-b]pyridine-7-carboximidamide.
| Compound Name | N-(3-bromophenyl)-N-hydroxy-2-(2-methylsulfonylethylamino)-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
|---|---|
| PubChem CID | 122704591 |
| Molecular Formula | C16H17BrN6O3S |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | N-(3-bromophenyl)-N-hydroxy-2-(2-methylsulfonylethylamino)-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
| SMILES | [H]/N=C(/c1ccnc2nc(NCCS(C)(=O)=O)[nH]c12)N(O)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H17BrN6O3S/c1-27(25,26)8-7-20-16-21-13-12(5-6-19-15(13)22-16)14(18)23(24)11-4-2-3-10(17)9-11/h2-6,9,18,24H,7-8H2,1H3,(H2,19,20,21,22)/b18-14- |
| InChIKey | NBPUZZCJPWBYOG-JXAWBTAJSA-N |
| XLogP | 2.40 |
| TPSA | 135.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|