C17H21N5O3 — CID 122705260
3-[4-amino-1-(2,2-diethoxyethyl)pyrazolo[3,4-d]pyrimidin-3-yl]phenol (PubChem CID 122705260) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 3-[4-amino-1-(2,2-diethoxyethyl)pyrazolo[3,4-d]pyrimidin-3-yl]phenol.
| Compound Name | 3-[4-amino-1-(2,2-diethoxyethyl)pyrazolo[3,4-d]pyrimidin-3-yl]phenol |
|---|---|
| PubChem CID | 122705260 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 3-[4-amino-1-(2,2-diethoxyethyl)pyrazolo[3,4-d]pyrimidin-3-yl]phenol |
| SMILES | CCOC(Cn1nc(-c2cccc(O)c2)c2c(N)ncnc21)OCC |
| InChI | InChI=1S/C17H21N5O3/c1-3-24-13(25-4-2)9-22-17-14(16(18)19-10-20-17)15(21-22)11-6-5-7-12(23)8-11/h5-8,10,13,23H,3-4,9H2,1-2H3,(H2,18,19,20) |
| InChIKey | JTVUIGUQYAYWOC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|