C21H17ClF4N2O3 — CID 122705275
1-[2-(4-chlorophenyl)-2,2-difluoroethyl]-3-[2,2-difluoro-2-(4-methylphenyl)ethyl]-1,3-diazinane-2,4,6-trione (PubChem CID 122705275) has the molecular formula C21H17ClF4N2O3 and a molecular weight of 456.82 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-2,2-difluoroethyl]-3-[2,2-difluoro-2-(4-methylphenyl)ethyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[2-(4-chlorophenyl)-2,2-difluoroethyl]-3-[2,2-difluoro-2-(4-methylphenyl)ethyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 122705275 |
| Molecular Formula | C21H17ClF4N2O3 |
| Molecular Weight | 456.82 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-2,2-difluoroethyl]-3-[2,2-difluoro-2-(4-methylphenyl)ethyl]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc(C(F)(F)CN2C(=O)CC(=O)N(CC(F)(F)c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H17ClF4N2O3/c1-13-2-4-14(5-3-13)20(23,24)11-27-17(29)10-18(30)28(19(27)31)12-21(25,26)15-6-8-16(22)9-7-15/h2-9H,10-12H2,1H3 |
| InChIKey | YFMUZMQAGQPJQK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.82 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|