C20H22N4O2 — CID 122705566
(E)-3-[5-[2-methyl-6-(2-methylpropoxy)-4-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide (PubChem CID 122705566) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is (E)-3-[5-[2-methyl-6-(2-methylpropoxy)-4-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide.
| Compound Name | (E)-3-[5-[2-methyl-6-(2-methylpropoxy)-4-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 122705566 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (E)-3-[5-[2-methyl-6-(2-methylpropoxy)-4-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
| SMILES | Cc1cc(-c2cnc3[nH]cc(/C=C/C(N)=O)c3c2)cc(OCC(C)C)n1 |
| InChI | InChI=1S/C20H22N4O2/c1-12(2)11-26-19-8-15(6-13(3)24-19)16-7-17-14(4-5-18(21)25)9-22-20(17)23-10-16/h4-10,12H,11H2,1-3H3,(H2,21,25)(H,22,23)/b5-4+ |
| InChIKey | DWRWXWWJNAVQAP-SNAWJCMRSA-N |
| XLogP | 3.47 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|