About ethyl thieno[3,2-d]pyrimidine-4-carboxylate
ethyl thieno[3,2-d]pyrimidine-4-carboxylate (PubChem CID 122705955) has the molecular formula C9H8N2O2S
and a molecular weight of 208.24 g/mol. Its IUPAC name is ethyl thieno[3,2-d]pyrimidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl thieno[3,2-d]pyrimidine-4-carboxylate |
| PubChem CID | 122705955 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | ethyl thieno[3,2-d]pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)c1ncnc2ccsc12 |
| InChI | InChI=1S/C9H8N2O2S/c1-2-13-9(12)7-8-6(3-4-14-8)10-5-11-7/h3-5H,2H2,1H3 |
| InChIKey | BNWHXQVJCWDUEX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl thieno[3,2-d]pyrimidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl thieno[3,2-d]pyrimidine-4-carboxylate?
The IUPAC name of ethyl thieno[3,2-d]pyrimidine-4-carboxylate (CID 122705955) is ethyl thieno[3,2-d]pyrimidine-4-carboxylate.
What is the SMILES notation for ethyl thieno[3,2-d]pyrimidine-4-carboxylate?
The canonical SMILES for ethyl thieno[3,2-d]pyrimidine-4-carboxylate is CCOC(=O)c1ncnc2ccsc12.
What is the InChIKey of ethyl thieno[3,2-d]pyrimidine-4-carboxylate?
The InChIKey is BNWHXQVJCWDUEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2S/c1-2-13-9(12)7-8-6(3-4-14-8)10-5-11-7/h3-5H,2H2,1H3.
What are the key properties of ethyl thieno[3,2-d]pyrimidine-4-carboxylate?
ethyl thieno[3,2-d]pyrimidine-4-carboxylate has a molecular weight of 208.24 g/mol, XLogP of 1.87, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl thieno[3,2-d]pyrimidine-4-carboxylate is sourced from PubChem (CID 122705955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).