About (5S)-3,5-dihydroxy-5-(hydroxymethyl)-2-methoxycyclohex-2-en-1-one
(5S)-3,5-dihydroxy-5-(hydroxymethyl)-2-methoxycyclohex-2-en-1-one (PubChem CID 122706197) has the molecular formula C8H12O5
and a molecular weight of 188.18 g/mol. Its IUPAC name is (5S)-3,5-dihydroxy-5-(hydroxymethyl)-2-methoxycyclohex-2-en-1-one.
Molecular Properties
| Compound Name | (5S)-3,5-dihydroxy-5-(hydroxymethyl)-2-methoxycyclohex-2-en-1-one |
| PubChem CID | 122706197 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | (5S)-3,5-dihydroxy-5-(hydroxymethyl)-2-methoxycyclohex-2-en-1-one |
| SMILES | COC1=C(O)C[C@@](O)(CO)CC1=O |
| InChI | InChI=1S/C8H12O5/c1-13-7-5(10)2-8(12,4-9)3-6(7)11/h9-10,12H,2-4H2,1H3/t8-/m0/s1 |
| InChIKey | ZONRIYAALKITGT-QMMMGPOBSA-N |
| XLogP | -0.51 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5S)-3,5-dihydroxy-5-(hydroxymethyl)-2-methoxycyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-3,5-dihydroxy-5-(hydroxymethyl)-2-methoxycyclohex-2-en-1-one?
The IUPAC name of (5S)-3,5-dihydroxy-5-(hydroxymethyl)-2-methoxycyclohex-2-en-1-one (CID 122706197) is (5S)-3,5-dihydroxy-5-(hydroxymethyl)-2-methoxycyclohex-2-en-1-one.
What is the SMILES notation for (5S)-3,5-dihydroxy-5-(hydroxymethyl)-2-methoxycyclohex-2-en-1-one?
The canonical SMILES for (5S)-3,5-dihydroxy-5-(hydroxymethyl)-2-methoxycyclohex-2-en-1-one is COC1=C(O)C[C@@](O)(CO)CC1=O.
What is the InChIKey of (5S)-3,5-dihydroxy-5-(hydroxymethyl)-2-methoxycyclohex-2-en-1-one?
The InChIKey is ZONRIYAALKITGT-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H12O5/c1-13-7-5(10)2-8(12,4-9)3-6(7)11/h9-10,12H,2-4H2,1H3/t8-/m0/s1.
What are the key properties of (5S)-3,5-dihydroxy-5-(hydroxymethyl)-2-methoxycyclohex-2-en-1-one?
(5S)-3,5-dihydroxy-5-(hydroxymethyl)-2-methoxycyclohex-2-en-1-one has a molecular weight of 188.18 g/mol, XLogP of -0.51, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-3,5-dihydroxy-5-(hydroxymethyl)-2-methoxycyclohex-2-en-1-one is sourced from PubChem (CID 122706197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).