C11H16NO8- — CID 122706415
(1R,2R,3S,5S,7R)-2-acetamido-7-[(1R)-1,2-dihydroxyethyl]-3-hydroxy-6,8-dioxabicyclo[3.2.1]octane-5-carboxylate (PubChem CID 122706415) has the molecular formula C11H16NO8- and a molecular weight of 290.25 g/mol. Its IUPAC name is (1R,2R,3S,5S,7R)-2-acetamido-7-[(1R)-1,2-dihydroxyethyl]-3-hydroxy-6,8-dioxabicyclo[3.2.1]octane-5-carboxylate.
| Compound Name | (1R,2R,3S,5S,7R)-2-acetamido-7-[(1R)-1,2-dihydroxyethyl]-3-hydroxy-6,8-dioxabicyclo[3.2.1]octane-5-carboxylate |
|---|---|
| PubChem CID | 122706415 |
| Molecular Formula | C11H16NO8- |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (1R,2R,3S,5S,7R)-2-acetamido-7-[(1R)-1,2-dihydroxyethyl]-3-hydroxy-6,8-dioxabicyclo[3.2.1]octane-5-carboxylate |
| SMILES | CC(=O)N[C@H]1[C@H]2O[C@@](C(=O)[O-])(C[C@@H]1O)O[C@@H]2[C@H](O)CO |
| InChI | InChI=1S/C11H17NO8/c1-4(14)12-7-5(15)2-11(10(17)18)19-8(6(16)3-13)9(7)20-11/h5-9,13,15-16H,2-3H2,1H3,(H,12,14)(H,17,18)/p-1/t5-,6+,7+,8+,9+,11+/m0/s1 |
| InChIKey | NCMJSVDTRDLWJE-YRMXFSIDSA-M |
| XLogP | -4.16 |
| TPSA | 148.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | -4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |