About (Z)-1-hydroxy-1,4-dioxohex-2-en-2-olate
(Z)-1-hydroxy-1,4-dioxohex-2-en-2-olate (PubChem CID 122706421) has the molecular formula C6H7O4-
and a molecular weight of 143.12 g/mol. Its IUPAC name is (Z)-1-hydroxy-1,4-dioxohex-2-en-2-olate.
Molecular Properties
| Compound Name | (Z)-1-hydroxy-1,4-dioxohex-2-en-2-olate |
| PubChem CID | 122706421 |
| Molecular Formula | C6H7O4- |
| Molecular Weight | 143.12 g/mol |
| Exact Mass | 143.03 |
| IUPAC Name | (Z)-1-hydroxy-1,4-dioxohex-2-en-2-olate |
| SMILES | CCC(=O)/C=C(\[O-])C(=O)O |
| InChI | InChI=1S/C6H8O4/c1-2-4(7)3-5(8)6(9)10/h3,8H,2H2,1H3,(H,9,10)/p-1/b5-3- |
| InChIKey | VHEINOKIVZLNRP-HYXAFXHYSA-M |
| XLogP | -0.71 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.12 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-hydroxy-1,4-dioxohex-2-en-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-hydroxy-1,4-dioxohex-2-en-2-olate?
The IUPAC name of (Z)-1-hydroxy-1,4-dioxohex-2-en-2-olate (CID 122706421) is (Z)-1-hydroxy-1,4-dioxohex-2-en-2-olate.
What is the SMILES notation for (Z)-1-hydroxy-1,4-dioxohex-2-en-2-olate?
The canonical SMILES for (Z)-1-hydroxy-1,4-dioxohex-2-en-2-olate is CCC(=O)/C=C(\[O-])C(=O)O.
What is the InChIKey of (Z)-1-hydroxy-1,4-dioxohex-2-en-2-olate?
The InChIKey is VHEINOKIVZLNRP-HYXAFXHYSA-M. The full InChI is InChI=1S/C6H8O4/c1-2-4(7)3-5(8)6(9)10/h3,8H,2H2,1H3,(H,9,10)/p-1/b5-3-.
What are the key properties of (Z)-1-hydroxy-1,4-dioxohex-2-en-2-olate?
(Z)-1-hydroxy-1,4-dioxohex-2-en-2-olate has a molecular weight of 143.12 g/mol, XLogP of -0.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-hydroxy-1,4-dioxohex-2-en-2-olate is sourced from PubChem (CID 122706421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).