C7H7O4- — CID 122706594
2-[(2S)-3-methyl-5-oxo-2H-furan-2-yl]acetate (PubChem CID 122706594) has the molecular formula C7H7O4- and a molecular weight of 155.13 g/mol. Its IUPAC name is 2-[(2S)-3-methyl-5-oxo-2H-furan-2-yl]acetate.
| Compound Name | 2-[(2S)-3-methyl-5-oxo-2H-furan-2-yl]acetate |
|---|---|
| PubChem CID | 122706594 |
| Molecular Formula | C7H7O4- |
| Molecular Weight | 155.13 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | 2-[(2S)-3-methyl-5-oxo-2H-furan-2-yl]acetate |
| SMILES | CC1=CC(=O)O[C@H]1CC(=O)[O-] |
| InChI | InChI=1S/C7H8O4/c1-4-2-7(10)11-5(4)3-6(8)9/h2,5H,3H2,1H3,(H,8,9)/p-1/t5-/m0/s1 |
| InChIKey | GXEVIPDDAUJTCF-YFKPBYRVSA-M |
| XLogP | -1.00 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.13 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |