About coniferyl alcohol radical
coniferyl alcohol radical (PubChem CID 122706626) has the molecular formula C10H11O3
and a molecular weight of 179.19 g/mol.
Molecular Properties
| Compound Name | coniferyl alcohol radical |
| PubChem CID | 122706626 |
| Molecular Formula | C10H11O3 |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | — |
| SMILES | COC1=C/C(=C\[CH]CO)C=CC1=O |
| InChI | InChI=1S/C10H11O3/c1-13-10-7-8(3-2-6-11)4-5-9(10)12/h2-5,7,11H,6H2,1H3/b8-3- |
| InChIKey | ORAJWSYKRGVTDP-BAQGIRSFSA-N |
| XLogP | 0.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze coniferyl alcohol radical with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of coniferyl alcohol radical?
The IUPAC name of coniferyl alcohol radical (CID 122706626) is not available.
What is the SMILES notation for coniferyl alcohol radical?
The canonical SMILES for coniferyl alcohol radical is COC1=C/C(=C\[CH]CO)C=CC1=O.
What is the InChIKey of coniferyl alcohol radical?
The InChIKey is ORAJWSYKRGVTDP-BAQGIRSFSA-N. The full InChI is InChI=1S/C10H11O3/c1-13-10-7-8(3-2-6-11)4-5-9(10)12/h2-5,7,11H,6H2,1H3/b8-3-.
What are the key properties of coniferyl alcohol radical?
coniferyl alcohol radical has a molecular weight of 179.19 g/mol, XLogP of 0.78, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for coniferyl alcohol radical is sourced from PubChem (CID 122706626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).