About methyl 5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-[(E)-pent-1-enyl]furan-3-carboxylate
methyl 5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-[(E)-pent-1-enyl]furan-3-carboxylate (PubChem CID 122706826) has the molecular formula C18H24O4
and a molecular weight of 304.39 g/mol. Its IUPAC name is methyl 5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-[(E)-pent-1-enyl]furan-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-[(E)-pent-1-enyl]furan-3-carboxylate |
| PubChem CID | 122706826 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | methyl 5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-[(E)-pent-1-enyl]furan-3-carboxylate |
| SMILES | CC/C=C/C=C/C1(C)OC(/C=C/CCC)=C(C(=O)OC)C1=O |
| InChI | InChI=1S/C18H24O4/c1-5-7-9-11-13-18(3)16(19)15(17(20)21-4)14(22-18)12-10-8-6-2/h7,9-13H,5-6,8H2,1-4H3/b9-7+,12-10+,13-11+ |
| InChIKey | DDESGSWOBZVTLS-JPSRSCNUSA-N |
| XLogP | 3.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-[(E)-pent-1-enyl]furan-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-[(E)-pent-1-enyl]furan-3-carboxylate?
The IUPAC name of methyl 5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-[(E)-pent-1-enyl]furan-3-carboxylate (CID 122706826) is methyl 5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-[(E)-pent-1-enyl]furan-3-carboxylate.
What is the SMILES notation for methyl 5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-[(E)-pent-1-enyl]furan-3-carboxylate?
The canonical SMILES for methyl 5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-[(E)-pent-1-enyl]furan-3-carboxylate is CC/C=C/C=C/C1(C)OC(/C=C/CCC)=C(C(=O)OC)C1=O.
What is the InChIKey of methyl 5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-[(E)-pent-1-enyl]furan-3-carboxylate?
The InChIKey is DDESGSWOBZVTLS-JPSRSCNUSA-N. The full InChI is InChI=1S/C18H24O4/c1-5-7-9-11-13-18(3)16(19)15(17(20)21-4)14(22-18)12-10-8-6-2/h7,9-13H,5-6,8H2,1-4H3/b9-7+,12-10+,13-11+.
What are the key properties of methyl 5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-[(E)-pent-1-enyl]furan-3-carboxylate?
methyl 5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-[(E)-pent-1-enyl]furan-3-carboxylate has a molecular weight of 304.39 g/mol, XLogP of 3.65, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-[(E)-pent-1-enyl]furan-3-carboxylate is sourced from PubChem (CID 122706826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).