C24H22N2O4 — CID 122707016
ethyl (1S,2R,3R,4S,5E)-5-benzylidene-1'-methyl-2',6-dioxospiro[bicyclo[2.2.1]heptane-3,3'-pyrrolo[2,3-b]pyridine]-2-carboxylate (PubChem CID 122707016) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is ethyl (1S,2R,3R,4S,5E)-5-benzylidene-1'-methyl-2',6-dioxospiro[bicyclo[2.2.1]heptane-3,3'-pyrrolo[2,3-b]pyridine]-2-carboxylate.
| Compound Name | ethyl (1S,2R,3R,4S,5E)-5-benzylidene-1'-methyl-2',6-dioxospiro[bicyclo[2.2.1]heptane-3,3'-pyrrolo[2,3-b]pyridine]-2-carboxylate |
|---|---|
| PubChem CID | 122707016 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | ethyl (1S,2R,3R,4S,5E)-5-benzylidene-1'-methyl-2',6-dioxospiro[bicyclo[2.2.1]heptane-3,3'-pyrrolo[2,3-b]pyridine]-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2C[C@@H](/C(=C\c3ccccc3)C2=O)[C@@]12C(=O)N(C)c1ncccc12 |
| InChI | InChI=1S/C24H22N2O4/c1-3-30-22(28)19-16-13-18(15(20(16)27)12-14-8-5-4-6-9-14)24(19)17-10-7-11-25-21(17)26(2)23(24)29/h4-12,16,18-19H,3,13H2,1-2H3/b15-12+/t16-,18-,19-,24+/m0/s1 |
| InChIKey | UUGLVRROTPQPBD-WELZDIEPSA-N |
| XLogP | 2.78 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|