About 2-iminooxolane-3,4-diol
2-iminooxolane-3,4-diol (PubChem CID 122707056) has the molecular formula C4H7NO3
and a molecular weight of 117.10 g/mol. Its IUPAC name is 2-iminooxolane-3,4-diol.
Molecular Properties
| Compound Name | 2-iminooxolane-3,4-diol |
| PubChem CID | 122707056 |
| Molecular Formula | C4H7NO3 |
| Molecular Weight | 117.10 g/mol |
| Exact Mass | 117.04 |
| IUPAC Name | 2-iminooxolane-3,4-diol |
| SMILES | [H]/N=C1\OCC(O)C1O |
| InChI | InChI=1S/C4H7NO3/c5-4-3(7)2(6)1-8-4/h2-3,5-7H,1H2/b5-4- |
| InChIKey | ZDXQKWNLDZJTQL-PLNGDYQASA-N |
| XLogP | -1.28 |
| TPSA | 73.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.10 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-iminooxolane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iminooxolane-3,4-diol?
The IUPAC name of 2-iminooxolane-3,4-diol (CID 122707056) is 2-iminooxolane-3,4-diol.
What is the SMILES notation for 2-iminooxolane-3,4-diol?
The canonical SMILES for 2-iminooxolane-3,4-diol is [H]/N=C1\OCC(O)C1O.
What is the InChIKey of 2-iminooxolane-3,4-diol?
The InChIKey is ZDXQKWNLDZJTQL-PLNGDYQASA-N. The full InChI is InChI=1S/C4H7NO3/c5-4-3(7)2(6)1-8-4/h2-3,5-7H,1H2/b5-4-.
What are the key properties of 2-iminooxolane-3,4-diol?
2-iminooxolane-3,4-diol has a molecular weight of 117.10 g/mol, XLogP of -1.28, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iminooxolane-3,4-diol is sourced from PubChem (CID 122707056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).