About (E,Z)-N-(5-nitro-1,3-thiazol-2-yl)-3-phenylprop-2-en-1-imine
(E,Z)-N-(5-nitro-1,3-thiazol-2-yl)-3-phenylprop-2-en-1-imine (PubChem CID 122707277) has the molecular formula C12H9N3O2S
and a molecular weight of 259.29 g/mol. Its IUPAC name is (E,Z)-N-(5-nitro-1,3-thiazol-2-yl)-3-phenylprop-2-en-1-imine.
Molecular Properties
| Compound Name | (E,Z)-N-(5-nitro-1,3-thiazol-2-yl)-3-phenylprop-2-en-1-imine |
| PubChem CID | 122707277 |
| Molecular Formula | C12H9N3O2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | (E,Z)-N-(5-nitro-1,3-thiazol-2-yl)-3-phenylprop-2-en-1-imine |
| SMILES | O=[N+]([O-])c1cnc(/N=C/C=C\c2ccccc2)s1 |
| InChI | InChI=1S/C12H9N3O2S/c16-15(17)11-9-14-12(18-11)13-8-4-7-10-5-2-1-3-6-10/h1-9H/b7-4-,13-8+ |
| InChIKey | XFIHZTPZSSWIGX-PZADHXCOSA-N |
| XLogP | 3.47 |
| TPSA | 68.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E,Z)-N-(5-nitro-1,3-thiazol-2-yl)-3-phenylprop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,Z)-N-(5-nitro-1,3-thiazol-2-yl)-3-phenylprop-2-en-1-imine?
The IUPAC name of (E,Z)-N-(5-nitro-1,3-thiazol-2-yl)-3-phenylprop-2-en-1-imine (CID 122707277) is (E,Z)-N-(5-nitro-1,3-thiazol-2-yl)-3-phenylprop-2-en-1-imine.
What is the SMILES notation for (E,Z)-N-(5-nitro-1,3-thiazol-2-yl)-3-phenylprop-2-en-1-imine?
The canonical SMILES for (E,Z)-N-(5-nitro-1,3-thiazol-2-yl)-3-phenylprop-2-en-1-imine is O=[N+]([O-])c1cnc(/N=C/C=C\c2ccccc2)s1.
What is the InChIKey of (E,Z)-N-(5-nitro-1,3-thiazol-2-yl)-3-phenylprop-2-en-1-imine?
The InChIKey is XFIHZTPZSSWIGX-PZADHXCOSA-N. The full InChI is InChI=1S/C12H9N3O2S/c16-15(17)11-9-14-12(18-11)13-8-4-7-10-5-2-1-3-6-10/h1-9H/b7-4-,13-8+.
What are the key properties of (E,Z)-N-(5-nitro-1,3-thiazol-2-yl)-3-phenylprop-2-en-1-imine?
(E,Z)-N-(5-nitro-1,3-thiazol-2-yl)-3-phenylprop-2-en-1-imine has a molecular weight of 259.29 g/mol, XLogP of 3.47, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E,Z)-N-(5-nitro-1,3-thiazol-2-yl)-3-phenylprop-2-en-1-imine is sourced from PubChem (CID 122707277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).