About 3-iodoaniline
3-iodoaniline (PubChem CID 12271) has the molecular formula C6H6IN
and a molecular weight of 219.03 g/mol. Its IUPAC name is 3-iodoaniline.
Molecular Properties
| Compound Name | 3-iodoaniline |
| PubChem CID | 12271 |
| Molecular Formula | C6H6IN |
| Molecular Weight | 219.03 g/mol |
| Exact Mass | 218.95 |
| IUPAC Name | 3-iodoaniline |
| SMILES | Nc1cccc(I)c1 |
| InChI | InChI=1S/C6H6IN/c7-5-2-1-3-6(8)4-5/h1-4H,8H2 |
| InChIKey | FFCSRWGYGMRBGD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.03 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodoaniline?
The IUPAC name of 3-iodoaniline (CID 12271) is 3-iodoaniline.
What is the SMILES notation for 3-iodoaniline?
The canonical SMILES for 3-iodoaniline is Nc1cccc(I)c1.
What is the InChIKey of 3-iodoaniline?
The InChIKey is FFCSRWGYGMRBGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6IN/c7-5-2-1-3-6(8)4-5/h1-4H,8H2.
What are the key properties of 3-iodoaniline?
3-iodoaniline has a molecular weight of 219.03 g/mol, XLogP of 1.87, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodoaniline is sourced from PubChem (CID 12271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).