C15H15FN2O2S2 — CID 122712884
N-[(5E)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanamide (PubChem CID 122712884) has the molecular formula C15H15FN2O2S2 and a molecular weight of 338.43 g/mol. Its IUPAC name is N-[(5E)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanamide.
| Compound Name | N-[(5E)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanamide |
|---|---|
| PubChem CID | 122712884 |
| Molecular Formula | C15H15FN2O2S2 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | N-[(5E)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanamide |
| SMILES | CCCCC(=O)NN1C(=O)/C(=C\c2ccc(F)cc2)SC1=S |
| InChI | InChI=1S/C15H15FN2O2S2/c1-2-3-4-13(19)17-18-14(20)12(22-15(18)21)9-10-5-7-11(16)8-6-10/h5-9H,2-4H2,1H3,(H,17,19)/b12-9+ |
| InChIKey | SKQFEPAVLYQEQH-FMIVXFBMSA-N |
| XLogP | 3.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|