C16H18N2O5S2 — CID 122713010
ethyl 2-[[(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]acetate (PubChem CID 122713010) has the molecular formula C16H18N2O5S2 and a molecular weight of 382.46 g/mol. Its IUPAC name is ethyl 2-[[(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]acetate.
| Compound Name | ethyl 2-[[(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]acetate |
|---|---|
| PubChem CID | 122713010 |
| Molecular Formula | C16H18N2O5S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | ethyl 2-[[(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]acetate |
| SMILES | CCOC(=O)CNN1C(=O)/C(=C\c2ccc(OC)c(OC)c2)SC1=S |
| InChI | InChI=1S/C16H18N2O5S2/c1-4-23-14(19)9-17-18-15(20)13(25-16(18)24)8-10-5-6-11(21-2)12(7-10)22-3/h5-8,17H,4,9H2,1-3H3/b13-8+ |
| InChIKey | FZTHANPKVYSAKD-MDWZMJQESA-N |
| XLogP | 1.97 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|