C18H12Cl2N2OS2 — CID 122713476
(5E)-3-[(E)-(2,6-dichlorophenyl)methylideneamino]-5-[(4-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 122713476) has the molecular formula C18H12Cl2N2OS2 and a molecular weight of 407.35 g/mol. Its IUPAC name is (5E)-3-[(E)-(2,6-dichlorophenyl)methylideneamino]-5-[(4-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-[(E)-(2,6-dichlorophenyl)methylideneamino]-5-[(4-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 122713476 |
| Molecular Formula | C18H12Cl2N2OS2 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | (5E)-3-[(E)-(2,6-dichlorophenyl)methylideneamino]-5-[(4-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/C=C2/SC(=S)N(/N=C/c3c(Cl)cccc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C18H12Cl2N2OS2/c1-11-5-7-12(8-6-11)9-16-17(23)22(18(24)25-16)21-10-13-14(19)3-2-4-15(13)20/h2-10H,1H3/b16-9+,21-10+ |
| InChIKey | HPDORPTZNLMLIZ-PGZNPFONSA-N |
| XLogP | 5.54 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|