C22H20N4OS2 — CID 122713598
4-[(E)-[3-[(E)-[4-(diethylamino)phenyl]methylideneamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzonitrile (PubChem CID 122713598) has the molecular formula C22H20N4OS2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 4-[(E)-[3-[(E)-[4-(diethylamino)phenyl]methylideneamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzonitrile.
| Compound Name | 4-[(E)-[3-[(E)-[4-(diethylamino)phenyl]methylideneamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzonitrile |
|---|---|
| PubChem CID | 122713598 |
| Molecular Formula | C22H20N4OS2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 4-[(E)-[3-[(E)-[4-(diethylamino)phenyl]methylideneamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzonitrile |
| SMILES | CCN(CC)c1ccc(/C=N/N2C(=O)/C(=C\c3ccc(C#N)cc3)SC2=S)cc1 |
| InChI | InChI=1S/C22H20N4OS2/c1-3-25(4-2)19-11-9-18(10-12-19)15-24-26-21(27)20(29-22(26)28)13-16-5-7-17(14-23)8-6-16/h5-13,15H,3-4H2,1-2H3/b20-13+,24-15+ |
| InChIKey | UMWVAMPDOKUQFX-GTKRQGQJSA-N |
| XLogP | 4.64 |
| TPSA | 59.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|