C24H21N3OS2 — CID 122713710
(5Z)-3-(4-anilinophenyl)-5-[[4-(dimethylamino)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 122713710) has the molecular formula C24H21N3OS2 and a molecular weight of 431.59 g/mol. Its IUPAC name is (5Z)-3-(4-anilinophenyl)-5-[[4-(dimethylamino)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(4-anilinophenyl)-5-[[4-(dimethylamino)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 122713710 |
| Molecular Formula | C24H21N3OS2 |
| Molecular Weight | 431.59 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | (5Z)-3-(4-anilinophenyl)-5-[[4-(dimethylamino)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CN(C)c1ccc(/C=C2\SC(=S)N(c3ccc(Nc4ccccc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H21N3OS2/c1-26(2)20-12-8-17(9-13-20)16-22-23(28)27(24(29)30-22)21-14-10-19(11-15-21)25-18-6-4-3-5-7-18/h3-16,25H,1-2H3/b22-16- |
| InChIKey | VRKATPOCQOXYNB-JWGURIENSA-N |
| XLogP | 5.90 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.59 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|