About (Z)-1-(2,6-dichlorophenyl)-N-(1,3-thiazol-2-yl)methanimine
(Z)-1-(2,6-dichlorophenyl)-N-(1,3-thiazol-2-yl)methanimine (PubChem CID 122714082) has the molecular formula C10H6Cl2N2S
and a molecular weight of 257.15 g/mol. Its IUPAC name is (Z)-1-(2,6-dichlorophenyl)-N-(1,3-thiazol-2-yl)methanimine.
Molecular Properties
| Compound Name | (Z)-1-(2,6-dichlorophenyl)-N-(1,3-thiazol-2-yl)methanimine |
| PubChem CID | 122714082 |
| Molecular Formula | C10H6Cl2N2S |
| Molecular Weight | 257.15 g/mol |
| Exact Mass | 255.96 |
| IUPAC Name | (Z)-1-(2,6-dichlorophenyl)-N-(1,3-thiazol-2-yl)methanimine |
| SMILES | Clc1cccc(Cl)c1C=Nc1nccs1 |
| InChI | InChI=1S/C10H6Cl2N2S/c11-8-2-1-3-9(12)7(8)6-14-10-13-4-5-15-10/h1-6H |
| InChIKey | SIKPWTYPVIKBGX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.15 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(2,6-dichlorophenyl)-N-(1,3-thiazol-2-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(2,6-dichlorophenyl)-N-(1,3-thiazol-2-yl)methanimine?
The IUPAC name of (Z)-1-(2,6-dichlorophenyl)-N-(1,3-thiazol-2-yl)methanimine (CID 122714082) is (Z)-1-(2,6-dichlorophenyl)-N-(1,3-thiazol-2-yl)methanimine.
What is the SMILES notation for (Z)-1-(2,6-dichlorophenyl)-N-(1,3-thiazol-2-yl)methanimine?
The canonical SMILES for (Z)-1-(2,6-dichlorophenyl)-N-(1,3-thiazol-2-yl)methanimine is Clc1cccc(Cl)c1C=Nc1nccs1.
What is the InChIKey of (Z)-1-(2,6-dichlorophenyl)-N-(1,3-thiazol-2-yl)methanimine?
The InChIKey is SIKPWTYPVIKBGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Cl2N2S/c11-8-2-1-3-9(12)7(8)6-14-10-13-4-5-15-10/h1-6H.
What are the key properties of (Z)-1-(2,6-dichlorophenyl)-N-(1,3-thiazol-2-yl)methanimine?
(Z)-1-(2,6-dichlorophenyl)-N-(1,3-thiazol-2-yl)methanimine has a molecular weight of 257.15 g/mol, XLogP of 4.20, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(2,6-dichlorophenyl)-N-(1,3-thiazol-2-yl)methanimine is sourced from PubChem (CID 122714082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).