C26H35NO3 — CID 122714512
2-[3-methyl-1-[3-(4-methylphenyl)adamantane-1-carbonyl]piperidin-2-yl]acetic acid (PubChem CID 122714512) has the molecular formula C26H35NO3 and a molecular weight of 409.57 g/mol. Its IUPAC name is 2-[3-methyl-1-[3-(4-methylphenyl)adamantane-1-carbonyl]piperidin-2-yl]acetic acid.
| Compound Name | 2-[3-methyl-1-[3-(4-methylphenyl)adamantane-1-carbonyl]piperidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 122714512 |
| Molecular Formula | C26H35NO3 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | 2-[3-methyl-1-[3-(4-methylphenyl)adamantane-1-carbonyl]piperidin-2-yl]acetic acid |
| SMILES | Cc1ccc(C23CC4CC(CC(C(=O)N5CCCC(C)C5CC(=O)O)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C26H35NO3/c1-17-5-7-21(8-6-17)25-12-19-10-20(13-25)15-26(14-19,16-25)24(30)27-9-3-4-18(2)22(27)11-23(28)29/h5-8,18-20,22H,3-4,9-16H2,1-2H3,(H,28,29) |
| InChIKey | SUOPZFAPGQHPEV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |