C16H24ClNO4 — CID 122714551
1-[4-[2-hydroxy-3-(oxan-4-ylamino)propoxy]phenyl]ethanone;hydrochloride (PubChem CID 122714551) has the molecular formula C16H24ClNO4 and a molecular weight of 329.82 g/mol. Its IUPAC name is 1-[4-[2-hydroxy-3-(oxan-4-ylamino)propoxy]phenyl]ethanone;hydrochloride.
| Compound Name | 1-[4-[2-hydroxy-3-(oxan-4-ylamino)propoxy]phenyl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 122714551 |
| Molecular Formula | C16H24ClNO4 |
| Molecular Weight | 329.82 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 1-[4-[2-hydroxy-3-(oxan-4-ylamino)propoxy]phenyl]ethanone;hydrochloride |
| SMILES | CC(=O)c1ccc(OCC(O)CNC2CCOCC2)cc1.Cl |
| InChI | InChI=1S/C16H23NO4.ClH/c1-12(18)13-2-4-16(5-3-13)21-11-15(19)10-17-14-6-8-20-9-7-14;/h2-5,14-15,17,19H,6-11H2,1H3;1H |
| InChIKey | XSMRPPLLGOUWCH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.82 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |