About 5-bromo-2-(methoxymethyl)-1,2,4-triazol-3-amine
5-bromo-2-(methoxymethyl)-1,2,4-triazol-3-amine (PubChem CID 122714684) has the molecular formula C4H7BrN4O
and a molecular weight of 207.03 g/mol. Its IUPAC name is 5-bromo-2-(methoxymethyl)-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-bromo-2-(methoxymethyl)-1,2,4-triazol-3-amine |
| PubChem CID | 122714684 |
| Molecular Formula | C4H7BrN4O |
| Molecular Weight | 207.03 g/mol |
| Exact Mass | 205.98 |
| IUPAC Name | 5-bromo-2-(methoxymethyl)-1,2,4-triazol-3-amine |
| SMILES | COCn1nc(Br)nc1N |
| InChI | InChI=1S/C4H7BrN4O/c1-10-2-9-4(6)7-3(5)8-9/h2H2,1H3,(H2,6,7,8) |
| InChIKey | XCNWUIHOFUOSGV-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.03 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-2-(methoxymethyl)-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(methoxymethyl)-1,2,4-triazol-3-amine?
The IUPAC name of 5-bromo-2-(methoxymethyl)-1,2,4-triazol-3-amine (CID 122714684) is 5-bromo-2-(methoxymethyl)-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-bromo-2-(methoxymethyl)-1,2,4-triazol-3-amine?
The canonical SMILES for 5-bromo-2-(methoxymethyl)-1,2,4-triazol-3-amine is COCn1nc(Br)nc1N.
What is the InChIKey of 5-bromo-2-(methoxymethyl)-1,2,4-triazol-3-amine?
The InChIKey is XCNWUIHOFUOSGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7BrN4O/c1-10-2-9-4(6)7-3(5)8-9/h2H2,1H3,(H2,6,7,8).
What are the key properties of 5-bromo-2-(methoxymethyl)-1,2,4-triazol-3-amine?
5-bromo-2-(methoxymethyl)-1,2,4-triazol-3-amine has a molecular weight of 207.03 g/mol, XLogP of 0.23, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(methoxymethyl)-1,2,4-triazol-3-amine is sourced from PubChem (CID 122714684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).