About 2-ethyl-1-[5-(2-ethyl-3-methylimidazol-3-ium-1-yl)pentyl]-3-methylimidazol-3-ium diiodide
2-ethyl-1-[5-(2-ethyl-3-methylimidazol-3-ium-1-yl)pentyl]-3-methylimidazol-3-ium diiodide (PubChem CID 122714846) has the molecular formula C17H30I2N4
and a molecular weight of 544.26 g/mol. Its IUPAC name is 2-ethyl-1-[5-(2-ethyl-3-methylimidazol-3-ium-1-yl)pentyl]-3-methylimidazol-3-ium diiodide.
Molecular Properties
| Compound Name | 2-ethyl-1-[5-(2-ethyl-3-methylimidazol-3-ium-1-yl)pentyl]-3-methylimidazol-3-ium diiodide |
| PubChem CID | 122714846 |
| Molecular Formula | C17H30I2N4 |
| Molecular Weight | 544.26 g/mol |
| Exact Mass | 544.06 |
| IUPAC Name | 2-ethyl-1-[5-(2-ethyl-3-methylimidazol-3-ium-1-yl)pentyl]-3-methylimidazol-3-ium diiodide |
| SMILES | CCc1n(CCCCCn2cc[n+](C)c2CC)cc[n+]1C.[I-].[I-] |
| InChI | InChI=1S/C17H30N4.2HI/c1-5-16-18(3)12-14-20(16)10-8-7-9-11-21-15-13-19(4)17(21)6-2;;/h12-15H,5-11H2,1-4H3;2*1H/q+2;;/p-2 |
| InChIKey | PATUYEOPQURROQ-UHFFFAOYSA-L |
| XLogP | -4.06 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 544.26 |
| LogP ≤ 5 | -4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-1-[5-(2-ethyl-3-methylimidazol-3-ium-1-yl)pentyl]-3-methylimidazol-3-ium diiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-[5-(2-ethyl-3-methylimidazol-3-ium-1-yl)pentyl]-3-methylimidazol-3-ium diiodide?
The IUPAC name of 2-ethyl-1-[5-(2-ethyl-3-methylimidazol-3-ium-1-yl)pentyl]-3-methylimidazol-3-ium diiodide (CID 122714846) is 2-ethyl-1-[5-(2-ethyl-3-methylimidazol-3-ium-1-yl)pentyl]-3-methylimidazol-3-ium diiodide.
What is the SMILES notation for 2-ethyl-1-[5-(2-ethyl-3-methylimidazol-3-ium-1-yl)pentyl]-3-methylimidazol-3-ium diiodide?
The canonical SMILES for 2-ethyl-1-[5-(2-ethyl-3-methylimidazol-3-ium-1-yl)pentyl]-3-methylimidazol-3-ium diiodide is CCc1n(CCCCCn2cc[n+](C)c2CC)cc[n+]1C.[I-].[I-].
What is the InChIKey of 2-ethyl-1-[5-(2-ethyl-3-methylimidazol-3-ium-1-yl)pentyl]-3-methylimidazol-3-ium diiodide?
The InChIKey is PATUYEOPQURROQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C17H30N4.2HI/c1-5-16-18(3)12-14-20(16)10-8-7-9-11-21-15-13-19(4)17(21)6-2;;/h12-15H,5-11H2,1-4H3;2*1H/q+2;;/p-2.
What are the key properties of 2-ethyl-1-[5-(2-ethyl-3-methylimidazol-3-ium-1-yl)pentyl]-3-methylimidazol-3-ium diiodide?
2-ethyl-1-[5-(2-ethyl-3-methylimidazol-3-ium-1-yl)pentyl]-3-methylimidazol-3-ium diiodide has a molecular weight of 544.26 g/mol, XLogP of -4.06, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-[5-(2-ethyl-3-methylimidazol-3-ium-1-yl)pentyl]-3-methylimidazol-3-ium diiodide is sourced from PubChem (CID 122714846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).