C20H19N3O5 — CID 122714977
N-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide (PubChem CID 122714977) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is N-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide.
| Compound Name | N-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 122714977 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | N-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide |
| SMILES | COc1cc2c(cc1OC)C(NC(=O)c1ccc3[nH]c(=O)c(=O)[nH]c3c1)CC2 |
| InChI | InChI=1S/C20H19N3O5/c1-27-16-8-10-3-5-13(12(10)9-17(16)28-2)21-18(24)11-4-6-14-15(7-11)23-20(26)19(25)22-14/h4,6-9,13H,3,5H2,1-2H3,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | ORNRABIQRAQBAQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|