About benzene-1,3-dicarbonitrile
benzene-1,3-dicarbonitrile (PubChem CID 12276) has the molecular formula C8H4N2
and a molecular weight of 128.13 g/mol. Its IUPAC name is benzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | benzene-1,3-dicarbonitrile |
| PubChem CID | 12276 |
| Molecular Formula | C8H4N2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C8H4N2/c9-5-7-2-1-3-8(4-7)6-10/h1-4H |
| InChIKey | LAQPNDIUHRHNCV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3-dicarbonitrile?
The IUPAC name of benzene-1,3-dicarbonitrile (CID 12276) is benzene-1,3-dicarbonitrile.
What is the SMILES notation for benzene-1,3-dicarbonitrile?
The canonical SMILES for benzene-1,3-dicarbonitrile is N#Cc1cccc(C#N)c1.
What is the InChIKey of benzene-1,3-dicarbonitrile?
The InChIKey is LAQPNDIUHRHNCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2/c9-5-7-2-1-3-8(4-7)6-10/h1-4H.
What are the key properties of benzene-1,3-dicarbonitrile?
benzene-1,3-dicarbonitrile has a molecular weight of 128.13 g/mol, XLogP of 1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-dicarbonitrile is sourced from PubChem (CID 12276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).