C18H22N2O4S — CID 1227733
(1R,2R,3R,4S)-3-[[(3-methylthiophene-2-carbonyl)amino]carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 1227733) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is (1R,2R,3R,4S)-3-[[(3-methylthiophene-2-carbonyl)amino]carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1R,2R,3R,4S)-3-[[(3-methylthiophene-2-carbonyl)amino]carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 1227733 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (1R,2R,3R,4S)-3-[[(3-methylthiophene-2-carbonyl)amino]carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CC(C)=C1[C@H]2CC[C@@H]1[C@@H](C(=O)O)[C@@H]2C(=O)NNC(=O)c1sccc1C |
| InChI | InChI=1S/C18H22N2O4S/c1-8(2)12-10-4-5-11(12)14(18(23)24)13(10)16(21)19-20-17(22)15-9(3)6-7-25-15/h6-7,10-11,13-14H,4-5H2,1-3H3,(H,19,21)(H,20,22)(H,23,24)/t10-,11+,13-,14-/m1/s1 |
| InChIKey | FCUZTBBHXJMZQL-ZMJPVWNMSA-N |
| XLogP | 2.51 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|