About 4-bromo-3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazole
4-bromo-3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazole (PubChem CID 1227859) has the molecular formula C11H10BrN3O4S
and a molecular weight of 360.19 g/mol. Its IUPAC name is 4-bromo-3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazole.
Molecular Properties
| Compound Name | 4-bromo-3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazole |
| PubChem CID | 1227859 |
| Molecular Formula | C11H10BrN3O4S |
| Molecular Weight | 360.19 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | 4-bromo-3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazole |
| SMILES | Cc1nn(S(=O)(=O)c2cccc([N+](=O)[O-])c2)c(C)c1Br |
| InChI | InChI=1S/C11H10BrN3O4S/c1-7-11(12)8(2)14(13-7)20(18,19)10-5-3-4-9(6-10)15(16)17/h3-6H,1-2H3 |
| InChIKey | LUHLGLMJVBFLNS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 95.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.19 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazole?
The IUPAC name of 4-bromo-3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazole (CID 1227859) is 4-bromo-3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazole.
What is the SMILES notation for 4-bromo-3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazole?
The canonical SMILES for 4-bromo-3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazole is Cc1nn(S(=O)(=O)c2cccc([N+](=O)[O-])c2)c(C)c1Br.
What is the InChIKey of 4-bromo-3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazole?
The InChIKey is LUHLGLMJVBFLNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrN3O4S/c1-7-11(12)8(2)14(13-7)20(18,19)10-5-3-4-9(6-10)15(16)17/h3-6H,1-2H3.
What are the key properties of 4-bromo-3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazole?
4-bromo-3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazole has a molecular weight of 360.19 g/mol, XLogP of 2.41, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazole is sourced from PubChem (CID 1227859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).