About 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one
3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 1228885) has the molecular formula C15H9Br2NO2
and a molecular weight of 395.05 g/mol. Its IUPAC name is 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one.
Molecular Properties
| Compound Name | 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one |
| PubChem CID | 1228885 |
| Molecular Formula | C15H9Br2NO2 |
| Molecular Weight | 395.05 g/mol |
| Exact Mass | 392.90 |
| IUPAC Name | 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2C1=Cc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C15H9Br2NO2/c16-11-6-8(7-12(17)14(11)19)5-10-9-3-1-2-4-13(9)18-15(10)20/h1-7,19H,(H,18,20) |
| InChIKey | BBVGRROSWSHBNU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.05 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one?
The IUPAC name of 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one (CID 1228885) is 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one.
What is the SMILES notation for 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one?
The canonical SMILES for 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one is O=C1Nc2ccccc2C1=Cc1cc(Br)c(O)c(Br)c1.
What is the InChIKey of 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one?
The InChIKey is BBVGRROSWSHBNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9Br2NO2/c16-11-6-8(7-12(17)14(11)19)5-10-9-3-1-2-4-13(9)18-15(10)20/h1-7,19H,(H,18,20).
What are the key properties of 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one?
3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one has a molecular weight of 395.05 g/mol, XLogP of 4.41, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one is sourced from PubChem (CID 1228885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).