About 4-tert-Butylphthalic anhydride
4-tert-Butylphthalic anhydride (PubChem CID 122930) has the molecular formula C12H12O3
and a molecular weight of 204.22 g/mol. Its IUPAC name is 5-tert-butyl-2-benzofuran-1,3-dione.
Molecular Properties
| Compound Name | 4-tert-Butylphthalic anhydride |
| PubChem CID | 122930 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 5-tert-butyl-2-benzofuran-1,3-dione |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)C(=O)OC2=O |
| InChI | InChI=1S/C12H12O3/c1-12(2,3)7-4-5-8-9(6-7)11(14)15-10(8)13/h4-6H,1-3H3 |
| InChIKey | YLJYVKLZVHWUCT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | 300 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-Butylphthalic anhydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-Butylphthalic anhydride?
The IUPAC name of 4-tert-Butylphthalic anhydride (CID 122930) is 5-tert-butyl-2-benzofuran-1,3-dione.
What is the SMILES notation for 4-tert-Butylphthalic anhydride?
The canonical SMILES for 4-tert-Butylphthalic anhydride is CC(C)(C)C1=CC2=C(C=C1)C(=O)OC2=O.
What is the InChIKey of 4-tert-Butylphthalic anhydride?
The InChIKey is YLJYVKLZVHWUCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O3/c1-12(2,3)7-4-5-8-9(6-7)11(14)15-10(8)13/h4-6H,1-3H3.
What are the key properties of 4-tert-Butylphthalic anhydride?
4-tert-Butylphthalic anhydride has a molecular weight of 204.22 g/mol, XLogP of 3.00, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-Butylphthalic anhydride is sourced from PubChem (CID 122930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).