About N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetamide
N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 1229692) has the molecular formula C6H5F3N2OS
and a molecular weight of 210.18 g/mol. Its IUPAC name is N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 1229692 |
| Molecular Formula | C6H5F3N2OS |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C6H5F3N2OS/c1-3(12)10-5-11-4(2-13-5)6(7,8)9/h2H,1H3,(H,10,11,12) |
| InChIKey | XPLIDDGPWBSSCO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetamide?
The IUPAC name of N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetamide (CID 1229692) is N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetamide is CC(=O)Nc1nc(C(F)(F)F)cs1.
What is the InChIKey of N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetamide?
The InChIKey is XPLIDDGPWBSSCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F3N2OS/c1-3(12)10-5-11-4(2-13-5)6(7,8)9/h2H,1H3,(H,10,11,12).
What are the key properties of N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetamide?
N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetamide has a molecular weight of 210.18 g/mol, XLogP of 2.12, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 1229692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).