About hexan-2-ol
hexan-2-ol (PubChem CID 12297) has the molecular formula C6H14O
and a molecular weight of 102.18 g/mol. Its IUPAC name is hexan-2-ol.
Molecular Properties
| Compound Name | hexan-2-ol |
| PubChem CID | 12297 |
| Molecular Formula | C6H14O |
| Molecular Weight | 102.18 g/mol |
| Exact Mass | 102.10 |
| IUPAC Name | hexan-2-ol |
| SMILES | CCCCC(C)O |
| InChI | InChI=1S/C6H14O/c1-3-4-5-6(2)7/h6-7H,3-5H2,1-2H3 |
| InChIKey | QNVRIHYSUZMSGM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.18 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze hexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-2-ol?
The IUPAC name of hexan-2-ol (CID 12297) is hexan-2-ol.
What is the SMILES notation for hexan-2-ol?
The canonical SMILES for hexan-2-ol is CCCCC(C)O.
What is the InChIKey of hexan-2-ol?
The InChIKey is QNVRIHYSUZMSGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O/c1-3-4-5-6(2)7/h6-7H,3-5H2,1-2H3.
What are the key properties of hexan-2-ol?
hexan-2-ol has a molecular weight of 102.18 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-2-ol is sourced from PubChem (CID 12297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).