C18H19N — CID 1229702
(4bS,9bR)-8-propan-2-yl-4b,5,9b,10-tetrahydroindeno[1,2-b]indole (PubChem CID 1229702) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is (4bS,9bR)-8-propan-2-yl-4b,5,9b,10-tetrahydroindeno[1,2-b]indole.
| Compound Name | (4bS,9bR)-8-propan-2-yl-4b,5,9b,10-tetrahydroindeno[1,2-b]indole |
|---|---|
| PubChem CID | 1229702 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (4bS,9bR)-8-propan-2-yl-4b,5,9b,10-tetrahydroindeno[1,2-b]indole |
| SMILES | CC(C)c1ccc2c(c1)[C@H]1Cc3ccccc3[C@H]1N2 |
| InChI | InChI=1S/C18H19N/c1-11(2)12-7-8-17-15(9-12)16-10-13-5-3-4-6-14(13)18(16)19-17/h3-9,11,16,18-19H,10H2,1-2H3/t16-,18-/m1/s1 |
| InChIKey | ZXUTUFBDUNXMLT-SJLPKXTDSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_indane(1)', 'substructure': 'N/A'} |
|---|