C10H9FN2S — CID 1229841
4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-amine (PubChem CID 1229841) has the molecular formula C10H9FN2S and a molecular weight of 208.26 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-amine.
| Compound Name | 4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 1229841 |
| Molecular Formula | C10H9FN2S |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1sc(N)nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C10H9FN2S/c1-6-9(13-10(12)14-6)7-2-4-8(11)5-3-7/h2-5H,1H3,(H2,12,13) |
| InChIKey | KPOAMSWZRRKBHN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |