C26H23N3O — CID 1230006
(2,3-diphenylquinoxalin-6-yl)-piperidin-1-ylmethanone (PubChem CID 1230006) has the molecular formula C26H23N3O and a molecular weight of 393.49 g/mol. Its IUPAC name is (2,3-diphenylquinoxalin-6-yl)-piperidin-1-ylmethanone.
| Compound Name | (2,3-diphenylquinoxalin-6-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 1230006 |
| Molecular Formula | C26H23N3O |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | (2,3-diphenylquinoxalin-6-yl)-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc2nc(-c3ccccc3)c(-c3ccccc3)nc2c1)N1CCCCC1 |
| InChI | InChI=1S/C26H23N3O/c30-26(29-16-8-3-9-17-29)21-14-15-22-23(18-21)28-25(20-12-6-2-7-13-20)24(27-22)19-10-4-1-5-11-19/h1-2,4-7,10-15,18H,3,8-9,16-17H2 |
| InChIKey | BDEDTAFRAQLAGJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |