About 2-ethoxyacetic acid
2-ethoxyacetic acid (PubChem CID 12301) has the molecular formula C4H8O3
and a molecular weight of 104.11 g/mol. Its IUPAC name is 2-ethoxyacetic acid.
Molecular Properties
| Compound Name | 2-ethoxyacetic acid |
| PubChem CID | 12301 |
| Molecular Formula | C4H8O3 |
| Molecular Weight | 104.11 g/mol |
| Exact Mass | 104.05 |
| IUPAC Name | 2-ethoxyacetic acid |
| SMILES | CCOCC(=O)O |
| InChI | InChI=1S/C4H8O3/c1-2-7-3-4(5)6/h2-3H2,1H3,(H,5,6) |
| InChIKey | YZGQDNOIGFBYKF-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.11 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethoxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyacetic acid?
The IUPAC name of 2-ethoxyacetic acid (CID 12301) is 2-ethoxyacetic acid.
What is the SMILES notation for 2-ethoxyacetic acid?
The canonical SMILES for 2-ethoxyacetic acid is CCOCC(=O)O.
What is the InChIKey of 2-ethoxyacetic acid?
The InChIKey is YZGQDNOIGFBYKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3/c1-2-7-3-4(5)6/h2-3H2,1H3,(H,5,6).
What are the key properties of 2-ethoxyacetic acid?
2-ethoxyacetic acid has a molecular weight of 104.11 g/mol, XLogP of 0.11, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyacetic acid is sourced from PubChem (CID 12301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).