C19H26N2O2 — CID 1230280
(3S)-3-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-1-(4-methylphenyl)pyrrolidine-2,5-dione (PubChem CID 1230280) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is (3S)-3-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-1-(4-methylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-1-(4-methylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1230280 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | (3S)-3-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-1-(4-methylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C[C@H](N[C@@H]3CCC[C@H](C)[C@H]3C)C2=O)cc1 |
| InChI | InChI=1S/C19H26N2O2/c1-12-7-9-15(10-8-12)21-18(22)11-17(19(21)23)20-16-6-4-5-13(2)14(16)3/h7-10,13-14,16-17,20H,4-6,11H2,1-3H3/t13-,14+,16+,17-/m0/s1 |
| InChIKey | FICKTBOMIPGRMD-ABFRBSLYSA-N |
| XLogP | 3.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|