C27H22F2N2O2S — CID 1230681
(4S,7S)-N-(2,4-difluorophenyl)-2-methyl-5-oxo-7-phenyl-4-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide (PubChem CID 1230681) has the molecular formula C27H22F2N2O2S and a molecular weight of 476.55 g/mol. Its IUPAC name is (4S,7S)-N-(2,4-difluorophenyl)-2-methyl-5-oxo-7-phenyl-4-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide.
| Compound Name | (4S,7S)-N-(2,4-difluorophenyl)-2-methyl-5-oxo-7-phenyl-4-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 1230681 |
| Molecular Formula | C27H22F2N2O2S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | (4S,7S)-N-(2,4-difluorophenyl)-2-methyl-5-oxo-7-phenyl-4-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(F)cc2F)[C@@H](c2cccs2)C2=C(C[C@H](c3ccccc3)CC2=O)N1 |
| InChI | InChI=1S/C27H22F2N2O2S/c1-15-24(27(33)31-20-10-9-18(28)14-19(20)29)26(23-8-5-11-34-23)25-21(30-15)12-17(13-22(25)32)16-6-3-2-4-7-16/h2-11,14,17,26,30H,12-13H2,1H3,(H,31,33)/t17-,26+/m0/s1 |
| InChIKey | KLSQLFRMPMALCK-MRDQGFSESA-N |
| XLogP | 6.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |