About 3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid
3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid (PubChem CID 1230975) has the molecular formula C22H20N2O5
and a molecular weight of 392.41 g/mol. Its IUPAC name is 3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid.
Molecular Properties
| Compound Name | 3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid |
| PubChem CID | 1230975 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)c2ccc3c(c2)C(=O)N(C2CCCCC2)C3=O)c1 |
| InChI | InChI=1S/C22H20N2O5/c25-19(23-15-6-4-5-14(11-15)22(28)29)13-9-10-17-18(12-13)21(27)24(20(17)26)16-7-2-1-3-8-16/h4-6,9-12,16H,1-3,7-8H2,(H,23,25)(H,28,29) |
| InChIKey | FXDLPTVXBDPKOE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid?
The IUPAC name of 3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid (CID 1230975) is 3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid.
What is the SMILES notation for 3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid?
The canonical SMILES for 3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid is O=C(O)c1cccc(NC(=O)c2ccc3c(c2)C(=O)N(C2CCCCC2)C3=O)c1.
What is the InChIKey of 3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid?
The InChIKey is FXDLPTVXBDPKOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O5/c25-19(23-15-6-4-5-14(11-15)22(28)29)13-9-10-17-18(12-13)21(27)24(20(17)26)16-7-2-1-3-8-16/h4-6,9-12,16H,1-3,7-8H2,(H,23,25)(H,28,29).
What are the key properties of 3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid?
3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid has a molecular weight of 392.41 g/mol, XLogP of 3.57, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoic acid is sourced from PubChem (CID 1230975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).